Status: | WHO INN |
---|---|
IUPAC PIN: | N1,N1,N3,N3-tetraethyl-1,2,3-trithiodicarbonic diamide |
IUPAC name: | tetraethylthiuram monosulfide |
CAS name: | tetraethylthiodicarbonic diamide ([[(C2H5)2N]C(S)]2S) |
CAS Reg. No.: | 95-05-6 |
Formula: | C10H20N2S3 |
Activity: | acaricides (dithiocarbamate) |
Notes: | There is no ISO common name for this substance; the name “sulfiram” is approved by the World Health Organization, and the name “monosulfiram” was formerly approved by the British Pharmacopoeia Commission. |
Structure: | |
Pronunciation: | sǔl-fǐ-rǎm Guide to British pronunciation |
InChIKey: | CTPKSRZFJSJGML-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H20N2S3/c1-5-11(6-2)9(13)15-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names