| Status: | ISO 765 |
|---|---|
| IUPAC: | sodium pentachlorophenolate or sodium pentachlorophenoxide |
| CAS: | pentachlorophenol sodium salt |
| Reg. No.: | 131-52-2 |
| Formula: | C6Cl5NaO |
| Activity: | fungicides (aromatic fungicides) molluscicides |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “sodium pentachlorophenate” is given as an alternative. The parent alcohol is also considered not to require a common name, see pentachlorophenol. |
| Structure: |  |
| Pronunciation: | sō-dē-am pěn-ta-klor-ō-fěn-ǒk-sīd Guide to British pronunciation |
| InChI: | InChI=1/C6HCl5O.Na/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h12H;/q;+1/p-1/fC6Cl5O.Na/h12h;/q-1;m |