| Status: | ISO 765 |
|---|---|
| IUPAC: | sodium biphenyl-2-olate |
| CAS: | [1,1′-biphenyl]-2-ol sodium salt |
| Reg. No.: | 132-27-4 |
| Formula: | C12H9NaO |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “sodium o-phenylphenoxide” is given as an alternative. The parent alcohol is also considered not to require a common name, see 2-phenylphenol. |
| Structure: |  |
| Pronunciation: | sō-dē-am or-thō-fē-nīl-fěn-ǒk-sīd Guide to British pronunciation |
| InChIKey: | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| InChI: | InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1/p-1 |