| Status: | ISO 765 |
|---|---|
| IUPAC: | sodium chlorate |
| CAS: | sodium chlorate |
| Reg. No.: | 7775-09-9 |
| Formula: | ClNaO3 |
| Activity: | herbicides (inorganic herbicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | sō-dē-am klor-āt Guide to British pronunciation |
| InChI: | InChI=1/ClHO3.Na/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1/fClO3.Na/q-1;m |
A data sheet from the Compendium of Pesticide Common Names