| Status: | none |
|---|---|
| IUPAC: | sodium chloroacetate |
| CAS: | sodium chloroacetate |
| Reg. No.: | 3926-62-3 |
| Formula: | C2H2ClNaO2 |
| Activity: | herbicides (halogenated aliphatic herbicides) |
| Notes: | There is no ISO common name for this substance; the name “SMA” has been used in the literature but has no official status. ISO considers that monochloroacetic acid does not require a common name. |
| Structure: |  |
| InChI: | InChI=1/C2H3ClO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1/fC2H2ClO2.Na/q-1;m |