Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | N2,N4-diethyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
IUPAC name: | N2,N4-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS name: | N2,N4-diethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 1014-70-6 |
Formula: | C8H15N5S |
Activity: | herbicides (alkylthiotriazine) |
Notes: | The name “simetryne” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | sǐm-ē-trīn Guide to British pronunciation |
InChIKey: | MGLWZSOBALDPEK-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H15N5S/c1-4-9-6-11-7(10-5-2)13-8(12-6)14-3/h4-5H2,1-3H3,(H2,9,10,11,12,13) |
A data sheet from the Compendium of Pesticide Common Names