| Status: | BSI |
|---|---|
| IUPAC: | N2,N4-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| CAS: | N,N′-diethyl-6-methoxy-1,3,5-triazine-2,4-diamine |
| Reg. No.: | 673-04-1 |
| Formula: | C8H15N5O |
| Activity: | herbicides (methoxytriazine herbicides) |
| Notes: | There is no ISO common name for this substance; the name “simeton” is approved by the British Standards Institution and the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | sǐm-ē-tǒn Guide to British pronunciation |
| InChIKey: | HKAMKLBXTLTVCN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H15N5O/c1-4-9-6-11-7(10-5-2)13-8(12-6)14-3/h4-5H2,1-3H3,(H2,9,10,11,12,13) |
A data sheet from the Compendium of Pesticide Common Names