| Status: | ESA |
|---|---|
| IUPAC: | (RS)-sec-butyl (1RS,6RS;1RS,6SR)-6-methylcyclohex-3-ene-1-carboxylate |
| CAS: | 1-methylpropyl 6-methyl-3-cyclohexene-1-carboxylate |
| Reg. No.: | 2425-20-9 |
| Formula: | C12H20O2 |
| Activity: | insect attractants |
| Notes: | There is no ISO common name for this substance; the name “siglure” is approved by the Entomological Society of America. |
| Structure: | ![]() |
| InChI: | sp3 tetrahedral stereochemistry not specified InChI=1/C12H20O2/c1-4-10(3)14-12(13)11-8-6-5-7-9(11)2/h5-6,9-11H,4,7-8H2,1-3H3 all combinations of (R)- and (S)-stereoisomers InChI=1/C12H20O2/c1-4-10(3)14-12(13)11-8-6-5-7-9(11)2/h5-6,9-11H,4,7-8H2,1-3H3/t9?,10?,11? |
A data sheet from the Compendium of Pesticide Common Names