| Status: | ESA |
|---|---|
| IUPAC: | (RS)-5-{1-[2-(2-ethoxyethoxy)ethoxy]ethoxy}-1,3-benzodioxole |
| CAS: | 5-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-1,3-benzodioxole |
| Reg. No.: | 51-14-9 |
| Formula: | C15H22O6 |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “sesamex” is approved by the Entomological Society of America. |
| Structure: | ![]() |
| Pronunciation: | sě-sa-měks Guide to British pronunciation |
| InChI: | InChI=1/C15H22O6/c1-3-16-6-7-17-8-9-18-12(2)21-13-4-5-14-15(10-13)20-11-19-14/h4-5,10,12H,3,6-9,11H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names