| Status: | ISO 765 |
|---|---|
| IUPAC: | salicylanilide |
| CAS: | 2-hydroxy-N-phenylbenzamide |
| Reg. No.: | 87-17-2 |
| Formula: | C13H11NO2 |
| Activity: | fungicides (benzanilide fungicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | ![]() |
| Pronunciation: | sǎl-i-sīl-ǎn-ǐ-līd Guide to British pronunciation |
| InChI: | InChI=1/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16)/f/h14H |
A data sheet from the Compendium of Pesticide Common Names