| Status: | WHO INN |
|---|---|
| IUPAC: | 1-β-D-ribofuranosyl-1H-1,2,4-triazole-3-carboxamide |
| CAS: | 1-β-D-ribofuranosyl-1H-1,2,4-triazole-3-carboxamide |
| Reg. No.: | 36791-04-5 |
| Formula: | C8H12N4O5 |
| Activity: | virucides |
| Notes: | There is no ISO common name for this substance; the name “ribavirin” is approved by the World Health Organization. |
| Structure: | ![]() |
| Pronunciation: | rī-ba-vīr-ǐn Guide to British pronunciation |
| InChI: | InChI=1/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1/f/h9H2 |
A data sheet from the Compendium of Pesticide Common Names