Status: | China |
---|---|
IUPAC PIN: | dipropyl pyridine-2,5-dicarboxylate |
IUPAC name: | dipropyl pyridine-2,5-dicarboxylate or di-n-propyl isocinchomeronate |
CAS name: | dipropyl 2,5-pyridinedicarboxylate |
CAS Reg. No.: | 136-45-8 |
Formula: | C13H17NO4 |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “quyingding” (驱蝇啶) is approved in China. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | IITCWRFYJWUUPC-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H17NO4/c1-3-7-17-12(15)10-5-6-11(14-9-10)13(16)18-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names