| Status: | China |
|---|---|
| IUPAC: | ethyl N-acetyl-N-butyl-β-alaninate or ethyl 3-[acetyl(butyl)amino]propanoate |
| CAS: | ethyl N-acetyl-N-butyl-β-alaninate |
| Reg. No.: | 52304-36-6 |
| Formula: | C11H21NO3 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “quwenzhi” (驱蚊酯) is approved in China. |
| Structure: | ![]() |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | VZRKEAFHFMSHCD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H21NO3/c1-4-6-8-12(10(3)13)9-7-11(14)15-5-2/h4-9H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names