Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-amino-3-chloronaphthalene-1,4-dione |
IUPAC name: | 2-amino-3-chloro-1,4-naphthoquinone |
CAS name: | 2-amino-3-chloro-1,4-naphthalenedione |
CAS Reg. No.: | 2797-51-5 |
Formula: | C10H6ClNO2 |
Activity: | algicides herbicides (quinone) |
Notes: | The name “ACN” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | kwǐn-ō-kla-mēn Guide to British pronunciation |
InChIKey: | OBLNWSCLAYSJJR-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H6ClNO2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,12H2 |
A data sheet from the Compendium of Pesticide Common Names