| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 5-acetyl-8-quinolinol |
| CAS: | 1-(8-hydroxy-5-quinolinyl)ethanone |
| Reg. No.: | 57130-91-3 |
| Formula: | C11H9NO2 |
| Activity: | fungicides (quinoline fungicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example quinacetol sulfate [2598-31-4] for the 2:1 sulfate salt. The name “quinacetol sulphate” was formerly approved by ISO for the 2:1 sulfate salt, but this was replaced by the name “quinacetol” for the alcohol as part of a rationalisation exercise in 1989. |
| Structure: |  |
| InChI: | InChI=1/C11H9NO2/c1-7(13)8-4-5-10(14)11-9(8)3-2-6-12-11/h2-6,14H,1H3 |