Status: | China |
---|---|
IUPAC PIN: | 3-methyl-1-phenyl-1H-pyrazol-5-yl dimethylcarbamate |
IUPAC name: | 3-methyl-1-phenyl-1H-pyrazol-5-yl dimethylcarbamate |
CAS name: | 3-methyl-1-phenyl-1H-pyrazol-5-yl N,N-dimethylcarbamate |
CAS Reg. No.: | 87-47-8 |
Formula: | C13H15N3O2 |
Activity: | insecticides (dimethylcarbamate) |
Notes: | There is no ISO common name for this substance; the name “pyrolan” (吡唑威) is approved in China, even though Pyrolan is (or was) a registered trade mark in many countries. |
Structure: | |
Pronunciation: | pīr-ō-lǎn Guide to British pronunciation |
InChIKey: | GEDIWDLJKRKBFT-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H15N3O2/c1-10-9-12(18-13(17)15(2)3)16(14-10)11-7-5-4-6-8-11/h4-9H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names