
Chinese: 吡喃灵French: pyracarbolide (n.m.)Russian: пиракарболид

Status: ISO 1750 (published)
IUPAC PIN: 6-methyl-N-phenyl-3,4-dihydro-2H-pyran-5-carboxamide
IUPAC name: 3,4-dihydro-6-methyl-2H-pyran-5-carboxanilide
CAS name: 3,4-dihydro-6-methyl-N-phenyl-2H-pyran-5-carboxamide
CAS Reg. No.: 24691-76-7
Formula: C13H15NO2
Activity: fungicides (anilide fungicides)
Structure: Structural formula of pyracarbolid
Pronunciation: pīr-ǎ-kar-bō-lǐd  Guide to British pronunciation
InChI: InChI=1S/C13H15NO2/c1-10-12(8-5-9-16-10)13(15)14-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3,(H,14,15)

A data sheet from the Compendium of Pesticide Common Names