| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-isopropoxyphenyl methylcarbamate |
| CAS: | 2-(1-methylethoxy)phenyl methylcarbamate |
| Reg. No.: | 114-26-1 |
| Formula: | C11H15NO3 |
| Activity: | acaricides (carbamate acaricides) insecticides (phenyl methylcarbamate insecticides) |
| Notes: | The name “PHC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and the name “arprocarb” was formerly approved by the British Standards Institution. |
| Structure: | ![]() |
| InChI: | InChI=1/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names