| Status: | none |
|---|---|
| IUPAC: | 2-chloro-6′-ethyl-N-isopropoxymethylacet-o-toluidide |
| CAS: | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(1-methylethoxy)methyl]acetamide |
| Reg. No.: | 86763-47-5 |
| Formula: | C15H22ClNO2 |
| Activity: | herbicides (chloroacetanilide herbicides) |
| Notes: | There is no ISO common name for this substance; the name “propisochlor” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | prō-pī-sō-klor Guide to British pronunciation |
| InChI: | InChI=1/C15H22ClNO2/c1-5-13-8-6-7-12(4)15(13)17(14(18)9-16)10-19-11(2)3/h6-8,11H,5,9-10H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names