| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | isopropyl carbanilate or isopropyl phenylcarbamate |
| CAS: | 1-methylethyl phenylcarbamate |
| Reg. No.: | 122-42-9 |
| Formula: | C10H13NO2 |
| Activity: | herbicides (carbanilate herbicides) plant growth regulators (growth inhibitors) |
| Notes: | The name “IPC” (ИФК) was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | prō-fǎm Guide to British pronunciation |
| InChI: | InChI=1/C10H13NO2/c1-8(2)13-10(12)11-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,11,12)/f/h11H |
A data sheet from the Compendium of Pesticide Common Names