| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | propyl 3-(dimethylamino)propylcarbamate |
| CAS: | propyl [3-(dimethylamino)propyl]carbamate |
| Reg. No.: | 24579-73-5 |
| Formula: | C9H20N2O2 |
| Activity: | fungicides (carbamate fungicides) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example propamocarb hydrochloride [25606-41-1]. |
| Structure: | ![]() |
| Pronunciation: | prō-pǎm-ō-karb Guide to British pronunciation |
| InChI: | InChI=1/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12)/f/h10H |
A data sheet from the Compendium of Pesticide Common Names