Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | propyl [3-(dimethylamino)propyl]carbamate |
IUPAC name: | propyl [3-(dimethylamino)propyl]carbamate |
CAS name: | propyl N-[3-(dimethylamino)propyl]carbamate |
CAS Reg. No.: | 24579-73-5 |
Formula: | C9H20N2O2 |
Activity: | fungicides (carbamate) |
Notes: | When this substance is used as a salt, its identity should be stated, for example propamocarb hydrochloride [25606-41-1]. |
Structure: | |
Pronunciation: | prō-pǎm-ō-karb Guide to British pronunciation |
InChIKey: | WZZLDXDUQPOXNW-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12) |
A data sheet from the Compendium of Pesticide Common Names