| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | N2,N4-diisopropyl-6-methylthio-1,3,5-triazine-2,4-diamine |
| CAS: | N,N′-bis(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Reg. No.: | 7287-19-6 |
| Formula: | C10H19N5S |
| Activity: | herbicides (methylthiotriazine herbicides) |
| Notes: | The name “prometryne” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and was formerly approved by the British Standards Institution. |
| Structure: | ![]() |
| Pronunciation: | prō-mě-trīn Guide to British pronunciation |
| InChIKey: | AAEVYOVXGOFMJO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
A data sheet from the Compendium of Pesticide Common Names