| Status: | SAA |
|---|---|
| IUPAC: | 5-methyl-m-cumenyl butyryl(methyl)carbamate or 3-isopropyl-5-methylphenyl butyryl(methyl)carbamate |
| CAS: | 3-methyl-5-(1-methylethyl)phenyl methyl(1-oxobutyl)carbamate |
| Reg. No.: | 34264-24-9 |
| Formula: | C16H23NO3 |
| Activity: | acaricides (carbamate acaricides) insecticides (phenyl methylcarbamate insecticides) |
| Notes: | There is no ISO common name for this substance; the name “promacyl” is approved by the Standards Association of Australia. |
| Structure: | ![]() |
| Pronunciation: | prō-ma-sīl Guide to British pronunciation |
| InChI: | InChI=1/C16H23NO3/c1-6-7-15(18)17(5)16(19)20-14-9-12(4)8-13(10-14)11(2)3/h8-11H,6-7H2,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names