Status: | SAA |
---|---|
IUPAC PIN: | 3-methyl-5-(propan-2-yl)phenyl butanoyl(methyl)carbamate |
IUPAC name: | 5-methyl-m-cumenyl butyryl(methyl)carbamate or 3-isopropyl-5-methylphenyl butyryl(methyl)carbamate |
CAS name: | 3-methyl-5-(1-methylethyl)phenyl N-methyl-N-(1-oxobutyl)carbamate |
CAS Reg. No.: | 34264-24-9 |
Formula: | C16H23NO3 |
Activity: | acaricides (phenyl carbamate) insecticides (phenyl carbamate) |
Notes: | There is no ISO common name for this substance; the name “promacyl” is approved by the Standards Association of Australia, and is also approved in China (蜱虱威). |
Structure: | |
Pronunciation: | prō-ma-sīl Guide to British pronunciation |
InChIKey: | DXEMHWAAAJAXBG-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H23NO3/c1-6-7-15(18)17(5)16(19)20-14-9-12(4)8-13(10-14)11(2)3/h8-11H,6-7H2,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names