| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | propyl (1RS,2RS)-(3-oxo-2-pentylcyclopentyl)acetate containing 10±2% propyl (1RS,2SR)-(3-oxo-2-pentylcyclopentyl)acetate |
| CAS: | propyl (1R,2R)-rel-3-oxo-2-pentylcyclopentaneacetate |
| Reg. No.: | 158474-72-7 |
| Formula: | C15H26O3 |
| Activity: | plant growth regulators (growth inhibitors) |
| Notes: | The name “PDJ” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | prō-hī-drō-jaz-mǒn Guide to British pronunciation |
| InChI: | InChI=1/C15H26O3/c1-3-5-6-7-13-12(8-9-14(13)16)11-15(17)18-10-4-2/h12-13H,3-11H2,1-2H3/t12-,13-/s3 |
A data sheet from the Compendium of Pesticide Common Names