| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3,5-dioxo-4-propionylcyclohexanecarboxylic acid |
| CAS: | 3,5-dioxo-4-(1-oxopropyl)cyclohexanecarboxylic acid |
| Reg. No.: | 88805-35-0 |
| Formula: | C10H12O5 |
| Activity: | plant growth regulators (unclassified plant growth regulators) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example prohexadione-calcium [127277-53-6]. The name “调环酸” is approved in China for prohexadione and for prohexadione-calcium. |
| Structure: |  |
| Pronunciation: | prō-hěks-a-dī-ōn Guide to British pronunciation |
| InChIKey: | BUCOQPHDYUOJSI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,9H,2-4H2,1H3,(H,14,15) |