Status: | ISO 1750 (published) |
---|---|
IUPAC name: | N-[4-chloro-6-(isopropylamino)-1,3,5-triazin-2-yl]glycine |
CAS name: | N-[4-chloro-6-[(1-methylethyl)amino]-1,3,5-triazin-2-yl]glycine |
CAS Reg. No.: | 68228-20-6 |
Formula: | C8H12ClN5O2 |
Activity: | herbicides (chlorotriazine herbicides) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example proglinazine-ethyl [68228-18-2]. |
Structure: | |
Pronunciation: | prō-glǐn-a-zēn Guide to British pronunciation |
InChIKey: | XCXCBWSRDOSZRU-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H12ClN5O2/c1-4(2)11-8-13-6(9)12-7(14-8)10-3-5(15)16/h4H,3H2,1-2H3,(H,15,16)(H2,10,11,12,13,14) |
A data sheet from the Compendium of Pesticide Common Names