Status: | China |
---|---|
IUPAC PIN: | N,N-dimethyl-1,2,3,4,5-pentathiocan-7-amine |
IUPAC name: | N,N-dimethyl-1,2,3,4,5-pentathiocan-7-amine |
CAS name: | N,N-dimethyl-1,2,3,4,5-pentathiocan-7-amine |
CAS Reg. No.: | 114067-78-6 |
Formula: | C5H11NS5 |
Activity: | insecticides (nereistoxin analogue) |
Notes: | There is no ISO common name for this substance; the name “polythialan” (多噻烷) is approved in China. |
Structure: | |
Pronunciation: | pǒl-ē-thī-a-lǎn Guide to British pronunciation |
InChIKey: | KKJUPNGICOCCDW-UHFFFAOYSA-N |
InChI: | InChI=1S/C5H11NS5/c1-6(2)5-3-7-9-11-10-8-4-5/h5H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names