Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate |
IUPAC name: | 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate |
CAS name: | 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl N,N-dimethylcarbamate |
CAS Reg. No.: | 23103-98-2 |
Formula: | C11H18N4O2 |
Activity: | insecticides (dimethylcarbamate) |
Notes: | * According to ISO 1750, the name “pyrimicarbe” (n.m.) is used in France, but the ISO common name “pirimicarbe” (n.m.) also appears to be used. |
Structure: | |
Pronunciation: | pǐ-rǐm-ǐ-karb Guide to British pronunciation |
InChIKey: | YFGYUFNIOHWBOB-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H18N4O2/c1-7-8(2)12-10(14(3)4)13-9(7)17-11(16)15(5)6/h1-6H3 |
A data sheet from the Compendium of Pesticide Common Names