| Status: | China |
|---|---|
| IUPAC: | 3-[(2RS)-2-methylpiperidino]propyl 3,4-dichlorobenzoate |
| CAS: | 3-(2-methyl-1-piperidinyl)propyl 3,4-dichlorobenzoate |
| Reg. No.: | 3478-94-2 |
| Formula: | C16H21Cl2NO2 |
| Activity: | fungicides (unclassified fungicides) |
| Notes: | There is no ISO common name for this substance; the trivial name “piperalin” (哌丙灵) is approved as a common name in China. |
| Structure: | ![]() |
| Pronunciation: | pǐ-pěr-a-lǐn Guide to British pronunciation |
| InChIKey: | BZGLBXYQOMFXAU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H21Cl2NO2/c1-12-5-2-3-8-19(12)9-4-10-21-16(20)13-6-7-14(17)15(18)11-13/h6-7,11-12H,2-5,8-10H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names