| Status: |
JMAFF |
| IUPAC: |
4,5,6,7-tetrachlorophthalide |
| CAS: |
4,5,6,7-tetrachloro-1(3H)-isobenzofuranone |
| Reg. No.: |
27355-22-2 |
| Formula: |
C8H2Cl4O2 |
| Activity: |
fungicides (unclassified fungicides) |
| Notes: |
There is no ISO common name for this substance; the name “phthalide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries; the spelling “fthalide” is also used. |
| Structure: |
 |
| Pronunciation: |
fthǎl-īd Guide to British pronunciation |
| InChI: |
InChI=1/C8H2Cl4O2/c9-4-2-1-14-8(13)3(2)5(10)7(12)6(4)11/h1H2 |