| Status: |
ISO 1750 (published) |
| IUPAC: |
O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate |
| CAS: |
O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate |
| Reg. No.: |
5826-76-6 |
| Formula: |
C8H9ClNO5PS |
| Activity: |
insecticides (phenyl organothiophosphate insecticides) |
| Notes: |
* According to ISO 1750, the name “nichlorfos” is used in France, but the ISO common name “phosnichlor” also appears to be used. |
| Structure: |
 |
| Pronunciation: |
fǒs-nǐ-klor Guide to British pronunciation |
| InChIKey: |
UFNIXJPHHIPRFX-UHFFFAOYSA-N |
| InChI: |
InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-7(9)8(5-6)10(11)12/h3-5H,1-2H3 |