| Status: | China |
|---|---|
| IUPAC: | 2-chloro-5-(4-nitrophenoxy)phenyl propyl sulfoxide |
| CAS: | 1-chloro-4-(4-nitrophenoxy)-2-(propylsulfinyl)benzene |
| Reg. No.: | 49828-75-3 |
| Formula: | C15H14ClNO4S |
| Activity: | acaricides (bridged diphenyl acaricides) |
| Notes: | There is no ISO common name for this substance; the name “phenproxide” (苯螨醚) is approved in China. |
| Structure: | ![]() |
| Pronunciation: | fěn-prǒk-sīd Guide to British pronunciation |
| InChIKey: | SVZDUAFLNFAGIA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H14ClNO4S/c1-2-9-22(20)15-10-13(7-8-14(15)16)21-12-5-3-11(4-6-12)17(18)19/h3-8,10H,2,9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names