| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | methyl 3-(3-methylcarbaniloyloxy)carbanilate or 3-methoxycarbonylaminophenyl 3-methylcarbanilate |
| CAS: | 3-[(methoxycarbonyl)amino]phenyl N-(3-methylphenyl)carbamate |
| Reg. No.: | 13684-63-4 |
| Formula: | C16H16N2O4 |
| Activity: | herbicides (carbanilate herbicides) |
| Notes: | The analogous ethyl ester has the ISO common name phenmedipham-ethyl. |
| Structure: | ![]() |
| Pronunciation: | fěn-měd-ǐ-fǎm Guide to British pronunciation |
| InChIKey: | IDOWTHOLJBTAFI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H16N2O4/c1-11-5-3-6-12(9-11)18-16(20)22-14-8-4-7-13(10-14)17-15(19)21-2/h3-10H,1-2H3,(H,17,19)(H,18,20) |
A data sheet from the Compendium of Pesticide Common Names