Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 3-(ethoxyformamido)phenyl (3-methylphenyl)carbamate |
IUPAC name: | 3-[(ethoxyformyl)amino]phenyl (3-methylphenyl)carbamate 1979 Rules: 3-[(ethoxycarbonyl)amino]phenyl 3-methylcarbanilate |
CAS name: | 3-[(ethoxycarbonyl)amino]phenyl N-(3-methylphenyl)carbamate |
CAS Reg. No.: | 13684-44-1 |
Formula: | C17H18N2O4 |
Activity: | herbicides (phenyl carbamate) |
Notes: | The analogous methyl ester has the ISO common name phenmedipham [13684-63-4]. |
Structure: | |
Pronunciation: | fěn-měd-ǐ-fǎm ē-thīl Guide to British pronunciation |
InChIKey: | MVEFZZKZBYQFPP-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H18N2O4/c1-3-22-16(20)18-14-8-5-9-15(11-14)23-17(21)19-13-7-4-6-12(2)10-13/h4-11H,3H2,1-2H3,(H,18,20)(H,19,21) |
A data sheet from the Compendium of Pesticide Common Names