Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | phenazine 5-oxide |
IUPAC name: | phenazine 5-oxide |
CAS name: | phenazine 5-oxide |
CAS Reg. No.: | 304-81-4 |
Formula: | C12H8N2O |
Activity: | bactericides |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | fěn-a-zēn ǒks-īd Guide to British pronunciation |
InChIKey: | FFISWZPYNKWIRR-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H8N2O/c15-14-11-7-3-1-5-9(11)13-10-6-2-4-8-12(10)14/h1-8H |
A data sheet from the Compendium of Pesticide Common Names