| Status: |
ISO 1750 (published) |
| IUPAC: |
(RS)-3′-chloro-2-methylvaler-p-toluidide |
| CAS: |
N-(3-chloro-4-methylphenyl)-2-methylpentanamide |
| Reg. No.: |
2307-68-8 |
| Formula: |
C13H18ClNO |
| Activity: |
herbicides (anilide herbicides) |
| Notes: |
The name “solan” is used in Canada and is approved by the Weed Science Society of America, and the name “CMMP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |
 |
| Pronunciation: |
pěn-tǎn-ō-klor Guide to British pronunciation |
| InChI: |
InChI=1/C13H18ClNO/c1-4-5-10(3)13(16)15-11-7-6-9(2)12(14)8-11/h6-8,10H,4-5H2,1-3H3,(H,15,16)/f/h15H |