pelargonic acid

Chinese: 壬酸French: acide pélargonique (n.m.)Russian: пеларгоновая кислота

Status: ISO 765 (published)
IUPAC PIN: nonanoic acid
IUPAC name: nonanoic acid
CAS name: nonanoic acid
CAS Reg. No.: 112-05-0
Formula: C9H18O2
Activity: herbicides (unclassified herbicides)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of pelargonic acid
Pronunciation: pěl-ar-gǒn-ǐk ǎs-ǐd   Guide to British pronunciation
InChI: InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)

A data sheet from the Compendium of Pesticide Common Names