| Status: | WSSA |
|---|---|
| IUPAC: | nonanoic acid |
| CAS: | nonanoic acid |
| Reg. No.: | 112-05-0 |
| Formula: | C9H18O2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | There is no ISO common name for this substance; the old trivial name “pelargonic acid” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | pěl-ar-gǒn-ǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | FBUKVWPVBMHYJY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11) |