| Status: | ISO 765 |
|---|---|
| IUPAC: | p-dichlorobenzene |
| CAS: | 1,4-dichlorobenzene |
| Reg. No.: | 106-46-7 |
| Formula: | C6H4Cl2 |
| Activity: | insecticides (fumigant insecticides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “p-dichlorobenzene” is given as an alternative. |
| Structure: | ![]() |
| Pronunciation: | pǎr-a dī-klor-ō-běn-zēn Guide to British pronunciation |
| InChIKey: | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
A data sheet from the Compendium of Pesticide Common Names