| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (EZ)-N,N-dimethyl-2-methylcarbamoyloxyimino-2-(methylthio)acetamide |
| CAS: | methyl 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxoethanimidothioate |
| Reg. No.: | 23135-22-0 |
| Formula: | C7H13N3O3S |
| Activity: | acaricides (oxime carbamate acaricides) insecticides (oxime carbamate insecticides) nematicides (oxime carbamate nematicides) |
| Notes: | The name “thioxamyl” has been used in the literature, but has no official status. |
| Structure: | ![]() |
| Pronunciation: | ǒks-a-mīl Guide to British pronunciation |
| InChI: | InChI=1/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12)/f/h8H |
A data sheet from the Compendium of Pesticide Common Names