| Status: | USSR |
|---|---|
| IUPAC: | hexyl N,N-diethyloxamate |
| CAS: | hexyl (diethylamino)oxoacetate |
| Reg. No.: | 60254-65-1 |
| Formula: | C12H23NO3 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “oxamate” (оксамат) was used in the former USSR. |
| Structure: | ![]() |
| Pronunciation: | ǒks-a-māt Guide to British pronunciation |
| InChI: | InChI=1/C12H23NO3/c1-4-7-8-9-10-16-12(15)11(14)13(5-2)6-3/h4-10H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names