Status: | USSR |
---|---|
IUPAC PIN: | hexyl diethyloxamate |
IUPAC name: | hexyl diethyloxamate |
CAS name: | hexyl 2-(diethylamino)-2-oxoacetate |
CAS Reg. No.: | 60254-65-1 |
Formula: | C12H23NO3 |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “oxamate” (оксамат) was used in the former USSR. |
Structure: | |
Pronunciation: | ǒks-a-māt Guide to British pronunciation |
InChIKey: | MHDYJJCYEVKSPT-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H23NO3/c1-4-7-8-9-10-16-12(15)11(14)13(5-2)6-3/h4-10H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names