| Status: | none |
|---|---|
| IUPAC: | mixture of (E)-tetradec-11-en-1-yl acetate and (Z)-tetradec-11-en-1-yl acetate |
| CAS: | 11-tetradecenyl acetate |
| Reg. No.: | |
| Formula: | C16H30O2 |
| Activity: | insect attractants (straight chain lepidopteran pheromones) |
| Notes: | There is no ISO common name for this substance; the name “ostramone” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Ostrinia nubilalis (Hübner) (Pyralidae, Lepidoptera). |
| Structure: |  |
| Pronunciation: | ǒs-tra-mōn Guide to British pronunciation |
| InChI: | InChI=1/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-5H,3,6-15H2,1-2H3 |