| Status: | none |
|---|---|
| IUPAC: | ethyl (RS)-4-methyloctanoate |
| CAS: | ethyl 4-methyloctanoate |
| Reg. No.: | 56196-53-3 |
| Formula: | C11H22O2 |
| Activity: | insect attractants |
| Notes: | There is no ISO common name for this substance; the name “oryctalure” has been used in the literature but has no official status. |
| Structure: | ![]() |
| Pronunciation: | or-ǐk-ta-lūr Guide to British pronunciation |
| InChI: | InChI=1/C11H22O2/c1-4-6-7-10(3)8-9-11(12)13-5-2/h10H,4-9H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names