| Status: | ISO 765 |
|---|---|
| IUPAC: | o-dichlorobenzene |
| CAS: | 1,2-dichlorobenzene |
| Reg. No.: | 95-50-1 |
| Formula: | C6H4Cl2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “o-dichlorobenzene” is given as an alternative. The name “DCB” is approved by the Weed Science Society of America. |
| Structure: |  |
| InChI: | InChI=1/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |