Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-2-chloro-N-(2,6-dimethylphenyl)-N-[(3R)-2-oxooxolan-3-yl]acetamide |
IUPAC name: | 2-chloro-2′,6′-dimethyl-N-[(3RS)-2-oxotetrahydro-3-furyl]acetanilide 1979 Rules: (RS)-α-(2-chloro-N-2,6-xylylacetamido)-γ-butyrolactone |
CAS name: | 2-chloro-N-(2,6-dimethylphenyl)-N-(tetrahydro-2-oxo-3-furanyl)acetamide |
CAS Reg. No.: | 58810-48-3 |
Formula: | C14H16ClNO3 |
Activity: | fungicides (butyrolactone) |
Notes: | The Chinese name “甲呋酰胺” has also been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | ō-fūr-ās Guide to British pronunciation |
InChIKey: | OWDLFBLNMPCXSD-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H16ClNO3/c1-9-4-3-5-10(2)13(9)16(12(17)8-15)11-6-7-19-14(11)18/h3-5,11H,6-8H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names