Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
IUPAC name: | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
CAS name: | 3-[(2S)-1-methyl-2-pyrrolidinyl]pyridine |
CAS Reg. No.: | 54-11-5 |
Formula: | C10H14N2 |
Activity: | insecticides (alkaloid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. When this substance is used as a salt, its identity should be stated, for example nicotine sulfate [65-30-5]. |
Structure: | |
Pronunciation: | nǐk-ō-tēn Guide to British pronunciation |
InChIKey: | SNICXCGAKADSCV-JTQLQIEISA-N |
InChI: | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names