| Status: | ISO 765 |
|---|---|
| IUPAC: | (S)-3-(1-methylpyrrolidin-2-yl)pyridine |
| CAS: | 3-[(2S)-1-methyl-2-pyrrolidinyl]pyridine |
| Reg. No.: | 54-11-5 |
| Formula: | C10H14N2 |
| Activity: | insecticides (botanical insecticides) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. When this substance is used as a salt, its identity should be stated, for example nicotine sulfate [65-30-5]. |
| Structure: | ![]() |
| InChI: | InChI=1/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names