Status: | ISO 1750 (approved) |
---|---|
IUPAC PIN: | (2R)-N,N-diethyl-2-(naphthalen-1-yloxy)propanamide |
IUPAC name: | (2R)-N,N-diethyl-2-(1-naphthyloxy)propanamide 1979 Rules: (R)-N,N-diethyl-2-(1-naphthyloxy)propionamide |
CAS name: | (2R)-N,N-diethyl-2-(1-naphthalenyloxy)propanamide |
CAS Reg. No.: | 41643-35-0 |
Formula: | C17H21NO2 |
Activity: | herbicides (acetamide) |
Notes: | The unresolved enantiomeric mixture of this substance has the ISO common name napropamide [15299-99-7]. |
Structure: | |
Pronunciation: | nǎ-prō-pa-mīd ěm Guide to British pronunciation |
InChIKey: | WXZVAROIGSFCFJ-CYBMUJFWSA-N |
InChI: | InChI=1S/C17H21NO2/c1-4-18(5-2)17(19)13(3)20-16-12-8-10-14-9-6-7-11-15(14)16/h6-13H,4-5H2,1-3H3/t13-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names