| Status: | JMAFF |
|---|---|
| IUPAC: | (RS)-α-2-naphthoxypropionanilide |
| CAS: | 2-(2-naphthalenyloxy)-N-phenylpropanamide |
| Reg. No.: | 52570-16-8 |
| Formula: | C19H17NO2 |
| Activity: | herbicides (anilide herbicides) |
| Notes: | There is no ISO common name for this substance; the name “naproanilide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | nǎ-prō-ǎn-ǐ-līd Guide to British pronunciation |
| InChI: | InChI=1/C19H17NO2/c1-14(19(21)20-17-9-3-2-4-10-17)22-18-12-11-15-7-5-6-8-16(15)13-18/h2-14H,1H3,(H,20,21)/f/h20H |
A data sheet from the Compendium of Pesticide Common Names