Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 2-(naphthalen-1-yl)-1H-indene-1,3(2H)-dione |
IUPAC name: | 2-(1-naphthyl)indane-1,3-dione 1979 Rules: 2-(1-naphthyl)indan-1,3-dione |
CAS name: | 2-(1-naphthalenyl)-1H-indene-1,3(2H)-dione |
CAS Reg. No.: | 1786-03-4 |
Formula: | C19H12O2 |
Activity: | rodenticides (indandione) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. In ISO 765, the name given is “naphthylindane-1,3-diones”, which is plural, but there seems to be only one active isomer. |
Structure: | |
Pronunciation: | nǎf-thīl-ǐn-dān wǔn thrē dī-ōnz Guide to British pronunciation |
InChIKey: | CVLPPWGDNNZTRW-UHFFFAOYSA-N |
InChI: | InChI=1S/C19H12O2/c20-18-15-9-3-4-10-16(15)19(21)17(18)14-11-5-7-12-6-1-2-8-13(12)14/h1-11,17H |
A data sheet from the Compendium of Pesticide Common Names