naphthoxyacetic acids

French: acides naphtyloxyacétiques (n.m.pl.)Russian: нафтилуксусные кислоты


Status: ISO 765
PIN: (naphthalen-1-yloxy)acetic acid and/or (naphthalen-2-yloxy)acetic acid
IUPAC: (1-naphthyloxy)acetic acid and/or (2-naphthyloxy)acetic acid
CAS: 2-(1-naphthalenyloxy)acetic acid and/or 2-(2-naphthalenyloxy)acetic acid
Reg. No.: 1-isomer: 2976-75-2
2-isomer: 120-23-0
Formula: C12H10O3
Activity: plant growth regulators (auxins)
Notes: These substances are considered by the International Organization for Standardization not to require a common name; “naphthyloxyacetic acids” is given as an alternative.
Structure: Structural formulae of naphthoxyacetic acids
Pronunciation: nǎf-thǒk-sē-a--tǐk ǎs-ǐdz  Guide to British pronunciation
InChIKey: 1-isomer:
GHRYSOFWKRRLMI-UHFFFAOYSA-N
2-isomer:
RZCJYMOBWVJQGV-UHFFFAOYSA-N
InChI: 1-isomer:
InChI=1S/C12H10O3/c13-12(14)8-15-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8H2,(H,13,14)
2-isomer:
InChI=1S/C12H10O3/c13-12(14)8-15-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2,(H,13,14)

A data sheet from the Compendium of Pesticide Common Names