| Status: | ISO 765 |
|---|---|
| IUPAC: | (2-naphthyloxy)acetic acid |
| CAS: | (2-naphthalenyloxy)acetic acid |
| Reg. No.: | 120-23-0 |
| Formula: | C12H10O3 |
| Activity: | plant growth regulators (auxins) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name; “naphthyloxyacetic acid” is given as an alternative. In ISO 765, the name given is “naphthoxyacetic acids”, but there seems to be only one active isomer. |
| Structure: |  |
| Pronunciation: | nǎf-thǒk-sē-a-sē-tǐk ǎs-ǐd Guide to British pronunciation |
| InChI: | InChI=1/C12H10O3/c13-12(14)8-15-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2,(H,13,14)/f/h13H |